C23H33ClO2 — CID 162525677
6-(4-chloro-2-methylbutyl)-3,7-dimethyl-1-phenylbicyclo[3.3.1]nonane-3-carboxylic acid (PubChem CID 162525677) has the molecular formula C23H33ClO2 and a molecular weight of 376.97 g/mol. Its IUPAC name is 6-(4-chloro-2-methylbutyl)-3,7-dimethyl-1-phenylbicyclo[3.3.1]nonane-3-carboxylic acid.
| Compound Name | 6-(4-chloro-2-methylbutyl)-3,7-dimethyl-1-phenylbicyclo[3.3.1]nonane-3-carboxylic acid |
|---|---|
| PubChem CID | 162525677 |
| Molecular Formula | C23H33ClO2 |
| Molecular Weight | 376.97 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 6-(4-chloro-2-methylbutyl)-3,7-dimethyl-1-phenylbicyclo[3.3.1]nonane-3-carboxylic acid |
| SMILES | CC(CCCl)CC1C(C)CC2(c3ccccc3)CC1CC(C)(C(=O)O)C2 |
| InChI | InChI=1S/C23H33ClO2/c1-16(9-10-24)11-20-17(2)12-23(19-7-5-4-6-8-19)14-18(20)13-22(3,15-23)21(25)26/h4-8,16-18,20H,9-15H2,1-3H3,(H,25,26) |
| InChIKey | RJPULZNDKZQVAZ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.97 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|