C20H30ClNO — CID 162526001
6-(chloromethyl)-3,3,7-trimethyl-1-phenylbicyclo[3.3.1]nonane;formamide (PubChem CID 162526001) has the molecular formula C20H30ClNO and a molecular weight of 335.92 g/mol. Its IUPAC name is 6-(chloromethyl)-3,3,7-trimethyl-1-phenylbicyclo[3.3.1]nonane;formamide.
| Compound Name | 6-(chloromethyl)-3,3,7-trimethyl-1-phenylbicyclo[3.3.1]nonane;formamide |
|---|---|
| PubChem CID | 162526001 |
| Molecular Formula | C20H30ClNO |
| Molecular Weight | 335.92 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 6-(chloromethyl)-3,3,7-trimethyl-1-phenylbicyclo[3.3.1]nonane;formamide |
| SMILES | CC1CC2(c3ccccc3)CC(CC(C)(C)C2)C1CCl.NC=O |
| InChI | InChI=1S/C19H27Cl.CH3NO/c1-14-9-19(16-7-5-4-6-8-16)11-15(17(14)12-20)10-18(2,3)13-19;2-1-3/h4-8,14-15,17H,9-13H2,1-3H3;1H,(H2,2,3) |
| InChIKey | OBJXLTORVNPNJZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.92 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|