C29H47ClN2S — CID 162525970
4-amino-3,3-dimethylpiperidine-1-carbothialdehyde;6-(3-chloropropyl)-3,3,7-trimethyl-1-phenylbicyclo[3.3.1]nonane (PubChem CID 162525970) has the molecular formula C29H47ClN2S and a molecular weight of 491.23 g/mol. Its IUPAC name is 4-amino-3,3-dimethylpiperidine-1-carbothialdehyde;6-(3-chloropropyl)-3,3,7-trimethyl-1-phenylbicyclo[3.3.1]nonane.
| Compound Name | 4-amino-3,3-dimethylpiperidine-1-carbothialdehyde;6-(3-chloropropyl)-3,3,7-trimethyl-1-phenylbicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 162525970 |
| Molecular Formula | C29H47ClN2S |
| Molecular Weight | 491.23 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | 4-amino-3,3-dimethylpiperidine-1-carbothialdehyde;6-(3-chloropropyl)-3,3,7-trimethyl-1-phenylbicyclo[3.3.1]nonane |
| SMILES | CC1(C)CN(C=S)CCC1N.CC1CC2(c3ccccc3)CC(CC(C)(C)C2)C1CCCCl |
| InChI | InChI=1S/C21H31Cl.C8H16N2S/c1-16-12-21(18-8-5-4-6-9-18)14-17(13-20(2,3)15-21)19(16)10-7-11-22;1-8(2)5-10(6-11)4-3-7(8)9/h4-6,8-9,16-17,19H,7,10-15H2,1-3H3;6-7H,3-5,9H2,1-2H3 |
| InChIKey | YUJCJHCWUBDYLU-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.23 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|