C25H37ClN2S — CID 166985081
[(4S)-4-amino-3,3-dimethylpiperidin-1-yl]-[7-(chloromethyl)-3-methyl-5-phenyl-2-bicyclo[3.3.1]nonanyl]methanethione (PubChem CID 166985081) has the molecular formula C25H37ClN2S and a molecular weight of 433.11 g/mol. Its IUPAC name is [(4S)-4-amino-3,3-dimethylpiperidin-1-yl]-[7-(chloromethyl)-3-methyl-5-phenyl-2-bicyclo[3.3.1]nonanyl]methanethione.
| Compound Name | [(4S)-4-amino-3,3-dimethylpiperidin-1-yl]-[7-(chloromethyl)-3-methyl-5-phenyl-2-bicyclo[3.3.1]nonanyl]methanethione |
|---|---|
| PubChem CID | 166985081 |
| Molecular Formula | C25H37ClN2S |
| Molecular Weight | 433.11 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | [(4S)-4-amino-3,3-dimethylpiperidin-1-yl]-[7-(chloromethyl)-3-methyl-5-phenyl-2-bicyclo[3.3.1]nonanyl]methanethione |
| SMILES | CC1CC2(c3ccccc3)CC(CCl)CC(C2)C1C(=S)N1CC[C@H](N)C(C)(C)C1 |
| InChI | InChI=1S/C25H37ClN2S/c1-17-12-25(20-7-5-4-6-8-20)13-18(15-26)11-19(14-25)22(17)23(29)28-10-9-21(27)24(2,3)16-28/h4-8,17-19,21-22H,9-16,27H2,1-3H3/t17?,18?,19?,21-,22?,25?/m0/s1 |
| InChIKey | UNHDQPUFHLJXNZ-JTYDIGIMSA-N |
| XLogP | 5.62 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.11 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|