C27H44N2S — CID 162525292
3,6,7-trimethyl-1-phenylbicyclo[3.3.1]nonane-3-carbothialdehyde;1,3,3-trimethylpiperidin-4-amine (PubChem CID 162525292) has the molecular formula C27H44N2S and a molecular weight of 428.73 g/mol. Its IUPAC name is 3,6,7-trimethyl-1-phenylbicyclo[3.3.1]nonane-3-carbothialdehyde;1,3,3-trimethylpiperidin-4-amine.
| Compound Name | 3,6,7-trimethyl-1-phenylbicyclo[3.3.1]nonane-3-carbothialdehyde;1,3,3-trimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 162525292 |
| Molecular Formula | C27H44N2S |
| Molecular Weight | 428.73 g/mol |
| Exact Mass | 428.32 |
| IUPAC Name | 3,6,7-trimethyl-1-phenylbicyclo[3.3.1]nonane-3-carbothialdehyde;1,3,3-trimethylpiperidin-4-amine |
| SMILES | CC1CC2(c3ccccc3)CC(CC(C)(C=S)C2)C1C.CN1CCC(N)C(C)(C)C1 |
| InChI | InChI=1S/C19H26S.C8H18N2/c1-14-9-19(17-7-5-4-6-8-17)11-16(15(14)2)10-18(3,12-19)13-20;1-8(2)6-10(3)5-4-7(8)9/h4-8,13-16H,9-12H2,1-3H3;7H,4-6,9H2,1-3H3 |
| InChIKey | LWJONJWYDWQGJJ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.73 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|