C28H40N2S — CID 162525288
[(4S)-4-amino-3,3-dimethylpiperidin-1-yl]-[6-(cyclopropylmethyl)-3-phenyl-1-adamantyl]methanethione (PubChem CID 162525288) has the molecular formula C28H40N2S and a molecular weight of 436.71 g/mol. Its IUPAC name is [(4S)-4-amino-3,3-dimethylpiperidin-1-yl]-[6-(cyclopropylmethyl)-3-phenyl-1-adamantyl]methanethione.
| Compound Name | [(4S)-4-amino-3,3-dimethylpiperidin-1-yl]-[6-(cyclopropylmethyl)-3-phenyl-1-adamantyl]methanethione |
|---|---|
| PubChem CID | 162525288 |
| Molecular Formula | C28H40N2S |
| Molecular Weight | 436.71 g/mol |
| Exact Mass | 436.29 |
| IUPAC Name | [(4S)-4-amino-3,3-dimethylpiperidin-1-yl]-[6-(cyclopropylmethyl)-3-phenyl-1-adamantyl]methanethione |
| SMILES | CC1(C)CN(C(=S)C23CC4CC(c5ccccc5)(CC(C2)C4CC2CC2)C3)CC[C@@H]1N |
| InChI | InChI=1S/C28H40N2S/c1-26(2)18-30(11-10-24(26)29)25(31)28-15-20-13-27(17-28,22-6-4-3-5-7-22)14-21(16-28)23(20)12-19-8-9-19/h3-7,19-21,23-24H,8-18,29H2,1-2H3/t20?,21?,23?,24-,27?,28?/m0/s1 |
| InChIKey | PDJVGODNNWFFNB-GEQDFUTGSA-N |
| XLogP | 5.94 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.71 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|