C27H37N3O — CID 175635779
[(4S)-4-amino-3,3-dimethylpiperidin-1-yl]-[6-(2-methyliminoethylidene)-3-phenyl-1-adamantyl]methanone (PubChem CID 175635779) has the molecular formula C27H37N3O and a molecular weight of 419.61 g/mol. Its IUPAC name is [(4S)-4-amino-3,3-dimethylpiperidin-1-yl]-[6-(2-methyliminoethylidene)-3-phenyl-1-adamantyl]methanone.
| Compound Name | [(4S)-4-amino-3,3-dimethylpiperidin-1-yl]-[6-(2-methyliminoethylidene)-3-phenyl-1-adamantyl]methanone |
|---|---|
| PubChem CID | 175635779 |
| Molecular Formula | C27H37N3O |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.29 |
| IUPAC Name | [(4S)-4-amino-3,3-dimethylpiperidin-1-yl]-[6-(2-methyliminoethylidene)-3-phenyl-1-adamantyl]methanone |
| SMILES | C/N=C/C=C1C2CC3(C(=O)N4CC[C@H](N)C(C)(C)C4)CC1CC(c1ccccc1)(C2)C3 |
| InChI | InChI=1S/C27H37N3O/c1-25(2)18-30(12-10-23(25)28)24(31)27-15-19-13-26(17-27,21-7-5-4-6-8-21)14-20(16-27)22(19)9-11-29-3/h4-9,11,19-20,23H,10,12-18,28H2,1-3H3/b22-9-,29-11+/t19?,20?,23-,26?,27?/m0/s1 |
| InChIKey | FMWNNCOFUQEZLD-RFVAMZHOSA-N |
| XLogP | 4.35 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|