C26H33N3O — CID 162526129
2-[5-[(4S)-4-amino-3,3-dimethylpiperidine-1-carbonyl]-7-phenyl-2-adamantylidene]acetonitrile (PubChem CID 162526129) has the molecular formula C26H33N3O and a molecular weight of 403.57 g/mol. Its IUPAC name is 2-[5-[(4S)-4-amino-3,3-dimethylpiperidine-1-carbonyl]-7-phenyl-2-adamantylidene]acetonitrile.
| Compound Name | 2-[5-[(4S)-4-amino-3,3-dimethylpiperidine-1-carbonyl]-7-phenyl-2-adamantylidene]acetonitrile |
|---|---|
| PubChem CID | 162526129 |
| Molecular Formula | C26H33N3O |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | 2-[5-[(4S)-4-amino-3,3-dimethylpiperidine-1-carbonyl]-7-phenyl-2-adamantylidene]acetonitrile |
| SMILES | CC1(C)CN(C(=O)C23CC4CC(c5ccccc5)(CC(C2)C4=CC#N)C3)CC[C@@H]1N |
| InChI | InChI=1S/C26H33N3O/c1-24(2)17-29(11-9-22(24)28)23(30)26-14-18-12-25(16-26,20-6-4-3-5-7-20)13-19(15-26)21(18)8-10-27/h3-8,18-19,22H,9,11-17,28H2,1-2H3/b21-8-/t18?,19?,22-,25?,26?/m0/s1 |
| InChIKey | LZJXDZMRNFQURV-GTECWRARSA-N |
| XLogP | 4.17 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|