C28H35NO — CID 175623619
(3-phenyl-6-prop-2-ynylidene-1-adamantyl)-[(4S)-3,3,4-trimethylpiperidin-1-yl]methanone (PubChem CID 175623619) has the molecular formula C28H35NO and a molecular weight of 401.59 g/mol. Its IUPAC name is (3-phenyl-6-prop-2-ynylidene-1-adamantyl)-[(4S)-3,3,4-trimethylpiperidin-1-yl]methanone.
| Compound Name | (3-phenyl-6-prop-2-ynylidene-1-adamantyl)-[(4S)-3,3,4-trimethylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 175623619 |
| Molecular Formula | C28H35NO |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | (3-phenyl-6-prop-2-ynylidene-1-adamantyl)-[(4S)-3,3,4-trimethylpiperidin-1-yl]methanone |
| SMILES | C#CC=C1C2CC3(C(=O)N4CC[C@H](C)C(C)(C)C4)CC1CC(c1ccccc1)(C2)C3 |
| InChI | InChI=1S/C28H35NO/c1-5-9-24-21-14-27(23-10-7-6-8-11-23)15-22(24)17-28(16-21,18-27)25(30)29-13-12-20(2)26(3,4)19-29/h1,6-11,20-22H,12-19H2,2-4H3/b24-9-/t20-,21?,22?,27?,28?/m0/s1 |
| InChIKey | OFNLZUMHBMLFGM-ROEVWLDNSA-N |
| XLogP | 5.59 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|