C27H36N2S — CID 166908406
[(4S)-4-amino-3,3-dimethylpiperidin-1-yl]-[(6Z)-6-(cyclopropylmethylidene)-1-phenyl-3-tricyclo[3.3.1.03,7]nonanyl]methanethione (PubChem CID 166908406) has the molecular formula C27H36N2S and a molecular weight of 420.67 g/mol. Its IUPAC name is [(4S)-4-amino-3,3-dimethylpiperidin-1-yl]-[(6Z)-6-(cyclopropylmethylidene)-1-phenyl-3-tricyclo[3.3.1.03,7]nonanyl]methanethione.
| Compound Name | [(4S)-4-amino-3,3-dimethylpiperidin-1-yl]-[(6Z)-6-(cyclopropylmethylidene)-1-phenyl-3-tricyclo[3.3.1.03,7]nonanyl]methanethione |
|---|---|
| PubChem CID | 166908406 |
| Molecular Formula | C27H36N2S |
| Molecular Weight | 420.67 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | [(4S)-4-amino-3,3-dimethylpiperidin-1-yl]-[(6Z)-6-(cyclopropylmethylidene)-1-phenyl-3-tricyclo[3.3.1.03,7]nonanyl]methanethione |
| SMILES | CC1(C)CN(C(=S)C23CC4CC(c5ccccc5)(CC2/C4=C\C2CC2)C3)CC[C@@H]1N |
| InChI | InChI=1S/C27H36N2S/c1-25(2)17-29(11-10-23(25)28)24(30)27-14-19-13-26(16-27,20-6-4-3-5-7-20)15-22(27)21(19)12-18-8-9-18/h3-7,12,18-19,22-23H,8-11,13-17,28H2,1-2H3/b21-12-/t19?,22?,23-,26?,27?/m0/s1 |
| InChIKey | WSZFINLTKQEDJP-SAQBKWHTSA-N |
| XLogP | 5.47 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.67 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|