C30H38N2S — CID 166908949
[(4S)-4-amino-3,3-dimethylpiperidin-1-yl]-(6-benzyl-1-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)methanethione (PubChem CID 166908949) has the molecular formula C30H38N2S and a molecular weight of 458.72 g/mol. Its IUPAC name is [(4S)-4-amino-3,3-dimethylpiperidin-1-yl]-(6-benzyl-1-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)methanethione.
| Compound Name | [(4S)-4-amino-3,3-dimethylpiperidin-1-yl]-(6-benzyl-1-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)methanethione |
|---|---|
| PubChem CID | 166908949 |
| Molecular Formula | C30H38N2S |
| Molecular Weight | 458.72 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | [(4S)-4-amino-3,3-dimethylpiperidin-1-yl]-(6-benzyl-1-phenyl-3-tricyclo[3.3.1.03,7]nonanyl)methanethione |
| SMILES | CC1(C)CN(C(=S)C23CC4CC(c5ccccc5)(CC2C4Cc2ccccc2)C3)CC[C@@H]1N |
| InChI | InChI=1S/C30H38N2S/c1-28(2)20-32(14-13-26(28)31)27(33)30-17-22-16-29(19-30,23-11-7-4-8-12-23)18-25(30)24(22)15-21-9-5-3-6-10-21/h3-12,22,24-26H,13-20,31H2,1-2H3/t22?,24?,25?,26-,29?,30?/m0/s1 |
| InChIKey | MTMFVNPGRQPGBM-DDKQDCOQSA-N |
| XLogP | 5.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.72 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|