C28H42N2S — CID 171762435
[(4S)-4-amino-3,3-dimethylpiperidin-1-yl]-(6-methyl-3-phenyl-6-propyl-1-adamantyl)methanethione (PubChem CID 171762435) has the molecular formula C28H42N2S and a molecular weight of 438.73 g/mol. Its IUPAC name is [(4S)-4-amino-3,3-dimethylpiperidin-1-yl]-(6-methyl-3-phenyl-6-propyl-1-adamantyl)methanethione.
| Compound Name | [(4S)-4-amino-3,3-dimethylpiperidin-1-yl]-(6-methyl-3-phenyl-6-propyl-1-adamantyl)methanethione |
|---|---|
| PubChem CID | 171762435 |
| Molecular Formula | C28H42N2S |
| Molecular Weight | 438.73 g/mol |
| Exact Mass | 438.31 |
| IUPAC Name | [(4S)-4-amino-3,3-dimethylpiperidin-1-yl]-(6-methyl-3-phenyl-6-propyl-1-adamantyl)methanethione |
| SMILES | CCCC1(C)C2CC3(C(=S)N4CC[C@H](N)C(C)(C)C4)CC1CC(c1ccccc1)(C2)C3 |
| InChI | InChI=1S/C28H42N2S/c1-5-12-26(4)21-14-27(20-9-7-6-8-10-20)15-22(26)17-28(16-21,18-27)24(31)30-13-11-23(29)25(2,3)19-30/h6-10,21-23H,5,11-19,29H2,1-4H3/t21?,22?,23-,26?,27?,28?/m0/s1 |
| InChIKey | WJFOJSQVADAQEW-KZKCAAGPSA-N |
| XLogP | 6.33 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.73 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|