C33H43N3S2 — CID 175628226
[(4S)-4-amino-3,3-dimethylpiperidin-1-yl]-(1'-benzylsulfanyl-3-phenylspiro[adamantane-6,2'-azetidine]-1-yl)methanethione (PubChem CID 175628226) has the molecular formula C33H43N3S2 and a molecular weight of 545.86 g/mol. Its IUPAC name is [(4S)-4-amino-3,3-dimethylpiperidin-1-yl]-(1'-benzylsulfanyl-3-phenylspiro[adamantane-6,2'-azetidine]-1-yl)methanethione.
| Compound Name | [(4S)-4-amino-3,3-dimethylpiperidin-1-yl]-(1'-benzylsulfanyl-3-phenylspiro[adamantane-6,2'-azetidine]-1-yl)methanethione |
|---|---|
| PubChem CID | 175628226 |
| Molecular Formula | C33H43N3S2 |
| Molecular Weight | 545.86 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | [(4S)-4-amino-3,3-dimethylpiperidin-1-yl]-(1'-benzylsulfanyl-3-phenylspiro[adamantane-6,2'-azetidine]-1-yl)methanethione |
| SMILES | CC1(C)CN(C(=S)C23CC4CC(c5ccccc5)(CC(C2)C42CCN2SCc2ccccc2)C3)CC[C@@H]1N |
| InChI | InChI=1S/C33H43N3S2/c1-30(2)23-35(15-13-28(30)34)29(37)32-19-26-17-31(22-32,25-11-7-4-8-12-25)18-27(20-32)33(26)14-16-36(33)38-21-24-9-5-3-6-10-24/h3-12,26-28H,13-23,34H2,1-2H3/t26?,27?,28-,31?,32?,33?/m0/s1 |
| InChIKey | VJOCYECDOSGABA-JOZNSCMRSA-N |
| XLogP | 6.81 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.86 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|