C19H25NS2 — CID 162525229
6-(methylsulfanylmethyl)-3-phenyladamantane-1-carbothioamide (PubChem CID 162525229) has the molecular formula C19H25NS2 and a molecular weight of 331.55 g/mol. Its IUPAC name is 6-(methylsulfanylmethyl)-3-phenyladamantane-1-carbothioamide.
| Compound Name | 6-(methylsulfanylmethyl)-3-phenyladamantane-1-carbothioamide |
|---|---|
| PubChem CID | 162525229 |
| Molecular Formula | C19H25NS2 |
| Molecular Weight | 331.55 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 6-(methylsulfanylmethyl)-3-phenyladamantane-1-carbothioamide |
| SMILES | CSCC1C2CC3(C(N)=S)CC1CC(c1ccccc1)(C2)C3 |
| InChI | InChI=1S/C19H25NS2/c1-22-11-16-13-7-18(15-5-3-2-4-6-15)8-14(16)10-19(9-13,12-18)17(20)21/h2-6,13-14,16H,7-12H2,1H3,(H2,20,21) |
| InChIKey | USUDAWKPKPDLSS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.55 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|