About 3-(2,2-difluoroethyl)-7-ethyl-5-phenylbicyclo[3.3.1]nonane-1-carbothioamide
3-(2,2-difluoroethyl)-7-ethyl-5-phenylbicyclo[3.3.1]nonane-1-carbothioamide (PubChem CID 162525470) has the molecular formula C20H27F2NS
and a molecular weight of 351.51 g/mol. Its IUPAC name is 3-(2,2-difluoroethyl)-7-ethyl-5-phenylbicyclo[3.3.1]nonane-1-carbothioamide.
Molecular Properties
| Compound Name | 3-(2,2-difluoroethyl)-7-ethyl-5-phenylbicyclo[3.3.1]nonane-1-carbothioamide |
| PubChem CID | 162525470 |
| Molecular Formula | C20H27F2NS |
| Molecular Weight | 351.51 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 3-(2,2-difluoroethyl)-7-ethyl-5-phenylbicyclo[3.3.1]nonane-1-carbothioamide |
| SMILES | CCC1CC2(C(N)=S)CC(CC(F)F)CC(c3ccccc3)(C1)C2 |
| InChI | InChI=1S/C20H27F2NS/c1-2-14-9-19(16-6-4-3-5-7-16)11-15(8-17(21)22)12-20(10-14,13-19)18(23)24/h3-7,14-15,17H,2,8-13H2,1H3,(H2,23,24) |
| InChIKey | AYMFKPGYIOCVTB-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.51 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,2-difluoroethyl)-7-ethyl-5-phenylbicyclo[3.3.1]nonane-1-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-difluoroethyl)-7-ethyl-5-phenylbicyclo[3.3.1]nonane-1-carbothioamide?
The IUPAC name of 3-(2,2-difluoroethyl)-7-ethyl-5-phenylbicyclo[3.3.1]nonane-1-carbothioamide (CID 162525470) is 3-(2,2-difluoroethyl)-7-ethyl-5-phenylbicyclo[3.3.1]nonane-1-carbothioamide.
What is the SMILES notation for 3-(2,2-difluoroethyl)-7-ethyl-5-phenylbicyclo[3.3.1]nonane-1-carbothioamide?
The canonical SMILES for 3-(2,2-difluoroethyl)-7-ethyl-5-phenylbicyclo[3.3.1]nonane-1-carbothioamide is CCC1CC2(C(N)=S)CC(CC(F)F)CC(c3ccccc3)(C1)C2.
What is the InChIKey of 3-(2,2-difluoroethyl)-7-ethyl-5-phenylbicyclo[3.3.1]nonane-1-carbothioamide?
The InChIKey is AYMFKPGYIOCVTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27F2NS/c1-2-14-9-19(16-6-4-3-5-7-16)11-15(8-17(21)22)12-20(10-14,13-19)18(23)24/h3-7,14-15,17H,2,8-13H2,1H3,(H2,23,24).
What are the key properties of 3-(2,2-difluoroethyl)-7-ethyl-5-phenylbicyclo[3.3.1]nonane-1-carbothioamide?
3-(2,2-difluoroethyl)-7-ethyl-5-phenylbicyclo[3.3.1]nonane-1-carbothioamide has a molecular weight of 351.51 g/mol, XLogP of 5.47, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoroethyl)-7-ethyl-5-phenylbicyclo[3.3.1]nonane-1-carbothioamide is sourced from PubChem (CID 162525470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).