C20H27F2NS — CID 162525470
3-(2,2-difluoroethyl)-7-ethyl-5-phenylbicyclo[3.3.1]nonane-1-carbothioamide (PubChem CID 162525470) has the molecular formula C20H27F2NS and a molecular weight of 351.51 g/mol. Its IUPAC name is 3-(2,2-difluoroethyl)-7-ethyl-5-phenylbicyclo[3.3.1]nonane-1-carbothioamide.
| Compound Name | 3-(2,2-difluoroethyl)-7-ethyl-5-phenylbicyclo[3.3.1]nonane-1-carbothioamide |
|---|---|
| PubChem CID | 162525470 |
| Molecular Formula | C20H27F2NS |
| Molecular Weight | 351.51 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 3-(2,2-difluoroethyl)-7-ethyl-5-phenylbicyclo[3.3.1]nonane-1-carbothioamide |
| SMILES | CCC1CC2(C(N)=S)CC(CC(F)F)CC(c3ccccc3)(C1)C2 |
| InChI | InChI=1S/C20H27F2NS/c1-2-14-9-19(16-6-4-3-5-7-16)11-15(8-17(21)22)12-20(10-14,13-19)18(23)24/h3-7,14-15,17H,2,8-13H2,1H3,(H2,23,24) |
| InChIKey | AYMFKPGYIOCVTB-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.51 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|