C19H25NOS — CID 162526146
6-ethoxy-3-phenyladamantane-1-carbothioamide (PubChem CID 162526146) has the molecular formula C19H25NOS and a molecular weight of 315.48 g/mol. Its IUPAC name is 6-ethoxy-3-phenyladamantane-1-carbothioamide.
| Compound Name | 6-ethoxy-3-phenyladamantane-1-carbothioamide |
|---|---|
| PubChem CID | 162526146 |
| Molecular Formula | C19H25NOS |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 6-ethoxy-3-phenyladamantane-1-carbothioamide |
| SMILES | CCOC1C2CC3(C(N)=S)CC1CC(c1ccccc1)(C2)C3 |
| InChI | InChI=1S/C19H25NOS/c1-2-21-16-13-8-18(15-6-4-3-5-7-15)9-14(16)11-19(10-13,12-18)17(20)22/h3-7,13-14,16H,2,8-12H2,1H3,(H2,20,22) |
| InChIKey | LVHXUIHQNAXTMB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|