C27H45ClN2O — CID 142519942
N-(4-aminocyclohexyl)formamide;chloroethane;3,3,7-trimethyl-1-phenylbicyclo[3.3.1]nonane (PubChem CID 142519942) has the molecular formula C27H45ClN2O and a molecular weight of 449.12 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)formamide;chloroethane;3,3,7-trimethyl-1-phenylbicyclo[3.3.1]nonane.
| Compound Name | N-(4-aminocyclohexyl)formamide;chloroethane;3,3,7-trimethyl-1-phenylbicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 142519942 |
| Molecular Formula | C27H45ClN2O |
| Molecular Weight | 449.12 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | N-(4-aminocyclohexyl)formamide;chloroethane;3,3,7-trimethyl-1-phenylbicyclo[3.3.1]nonane |
| SMILES | CC1CC2CC(C)(C)CC(c3ccccc3)(C1)C2.CCCl.NC1CCC(NC=O)CC1 |
| InChI | InChI=1S/C18H26.C7H14N2O.C2H5Cl/c1-14-9-15-11-17(2,3)13-18(10-14,12-15)16-7-5-4-6-8-16;8-6-1-3-7(4-2-6)9-5-10;1-2-3/h4-8,14-15H,9-13H2,1-3H3;5-7H,1-4,8H2,(H,9,10);2H2,1H3 |
| InChIKey | MVUFYWSPDHWAKD-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.12 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|