C28H47ClN2 — CID 142519904
chloroethane;N-[1-(3,7-dimethyl-1-phenyl-3-bicyclo[3.3.1]nonanyl)ethenyl]cyclohexanamine;methanamine (PubChem CID 142519904) has the molecular formula C28H47ClN2 and a molecular weight of 447.15 g/mol. Its IUPAC name is chloroethane;N-[1-(3,7-dimethyl-1-phenyl-3-bicyclo[3.3.1]nonanyl)ethenyl]cyclohexanamine;methanamine.
| Compound Name | chloroethane;N-[1-(3,7-dimethyl-1-phenyl-3-bicyclo[3.3.1]nonanyl)ethenyl]cyclohexanamine;methanamine |
|---|---|
| PubChem CID | 142519904 |
| Molecular Formula | C28H47ClN2 |
| Molecular Weight | 447.15 g/mol |
| Exact Mass | 446.34 |
| IUPAC Name | chloroethane;N-[1-(3,7-dimethyl-1-phenyl-3-bicyclo[3.3.1]nonanyl)ethenyl]cyclohexanamine;methanamine |
| SMILES | C=C(NC1CCCCC1)C1(C)CC2CC(C)CC(c3ccccc3)(C2)C1.CCCl.CN |
| InChI | InChI=1S/C25H37N.C2H5Cl.CH5N/c1-19-14-21-16-24(3,20(2)26-23-12-8-5-9-13-23)18-25(15-19,17-21)22-10-6-4-7-11-22;1-2-3;1-2/h4,6-7,10-11,19,21,23,26H,2,5,8-9,12-18H2,1,3H3;2H2,1H3;2H2,1H3 |
| InChIKey | MCSSBOCIEXRSDL-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.15 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|