C24H37FN2O — CID 162754729
fluoroethane;3-methyl-1-phenyl-N-piperidin-4-ylbicyclo[3.3.1]nonane-3-carboxamide (PubChem CID 162754729) has the molecular formula C24H37FN2O and a molecular weight of 388.57 g/mol. Its IUPAC name is fluoroethane;3-methyl-1-phenyl-N-piperidin-4-ylbicyclo[3.3.1]nonane-3-carboxamide.
| Compound Name | fluoroethane;3-methyl-1-phenyl-N-piperidin-4-ylbicyclo[3.3.1]nonane-3-carboxamide |
|---|---|
| PubChem CID | 162754729 |
| Molecular Formula | C24H37FN2O |
| Molecular Weight | 388.57 g/mol |
| Exact Mass | 388.29 |
| IUPAC Name | fluoroethane;3-methyl-1-phenyl-N-piperidin-4-ylbicyclo[3.3.1]nonane-3-carboxamide |
| SMILES | CC1(C(=O)NC2CCNCC2)CC2CCCC(c3ccccc3)(C2)C1.CCF |
| InChI | InChI=1S/C22H32N2O.C2H5F/c1-21(20(25)24-19-9-12-23-13-10-19)14-17-6-5-11-22(15-17,16-21)18-7-3-2-4-8-18;1-2-3/h2-4,7-8,17,19,23H,5-6,9-16H2,1H3,(H,24,25);2H2,1H3 |
| InChIKey | YDWGQPGRMLPSTF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.57 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |