C23H33NO — CID 162754696
N-cyclohexyl-3-methyl-1-phenylbicyclo[3.3.1]nonane-3-carboxamide (PubChem CID 162754696) has the molecular formula C23H33NO and a molecular weight of 339.52 g/mol. Its IUPAC name is N-cyclohexyl-3-methyl-1-phenylbicyclo[3.3.1]nonane-3-carboxamide.
| Compound Name | N-cyclohexyl-3-methyl-1-phenylbicyclo[3.3.1]nonane-3-carboxamide |
|---|---|
| PubChem CID | 162754696 |
| Molecular Formula | C23H33NO |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | N-cyclohexyl-3-methyl-1-phenylbicyclo[3.3.1]nonane-3-carboxamide |
| SMILES | CC1(C(=O)NC2CCCCC2)CC2CCCC(c3ccccc3)(C2)C1 |
| InChI | InChI=1S/C23H33NO/c1-22(21(25)24-20-12-6-3-7-13-20)15-18-9-8-14-23(16-18,17-22)19-10-4-2-5-11-19/h2,4-5,10-11,18,20H,3,6-9,12-17H2,1H3,(H,24,25) |
| InChIKey | CEVACNCSJUOSFL-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |