C11H19NO — CID 130162659
N-cyclohexyl-1-methylcyclopropane-1-carboxamide (PubChem CID 130162659) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is N-cyclohexyl-1-methylcyclopropane-1-carboxamide.
| Compound Name | N-cyclohexyl-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 130162659 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | N-cyclohexyl-1-methylcyclopropane-1-carboxamide |
| SMILES | CC1(C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C11H19NO/c1-11(7-8-11)10(13)12-9-5-3-2-4-6-9/h9H,2-8H2,1H3,(H,12,13) |
| InChIKey | YAXNXWMXWZXXPI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |