C9H15NO2 — CID 126981151
N-(3-hydroxycyclobutyl)-1-methylcyclopropane-1-carboxamide (PubChem CID 126981151) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is N-(3-hydroxycyclobutyl)-1-methylcyclopropane-1-carboxamide.
| Compound Name | N-(3-hydroxycyclobutyl)-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 126981151 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | N-(3-hydroxycyclobutyl)-1-methylcyclopropane-1-carboxamide |
| SMILES | CC1(C(=O)NC2CC(O)C2)CC1 |
| InChI | InChI=1S/C9H15NO2/c1-9(2-3-9)8(12)10-6-4-7(11)5-6/h6-7,11H,2-5H2,1H3,(H,10,12) |
| InChIKey | CDJSSNSMMSDIPP-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |