C26H42N2S — CID 162525710
N-cyclohexyl-3,7,7-trimethyl-1-phenylbicyclo[3.3.1]nonane-3-carbothioamide;methanamine (PubChem CID 162525710) has the molecular formula C26H42N2S and a molecular weight of 414.70 g/mol. Its IUPAC name is N-cyclohexyl-3,7,7-trimethyl-1-phenylbicyclo[3.3.1]nonane-3-carbothioamide;methanamine.
| Compound Name | N-cyclohexyl-3,7,7-trimethyl-1-phenylbicyclo[3.3.1]nonane-3-carbothioamide;methanamine |
|---|---|
| PubChem CID | 162525710 |
| Molecular Formula | C26H42N2S |
| Molecular Weight | 414.70 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | N-cyclohexyl-3,7,7-trimethyl-1-phenylbicyclo[3.3.1]nonane-3-carbothioamide;methanamine |
| SMILES | CC1(C)CC2CC(C)(C(=S)NC3CCCCC3)CC(c3ccccc3)(C2)C1.CN |
| InChI | InChI=1S/C25H37NS.CH5N/c1-23(2)14-19-15-24(3,22(27)26-21-12-8-5-9-13-21)18-25(16-19,17-23)20-10-6-4-7-11-20;1-2/h4,6-7,10-11,19,21H,5,8-9,12-18H2,1-3H3,(H,26,27);2H2,1H3 |
| InChIKey | VSYCXKSANZQGBR-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.70 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|