C19H30ClN3O3S — CID 119390296
1-ethylsulfonyl-4-phenyl-N-piperidin-4-ylpiperidine-4-carboxamide;hydrochloride (PubChem CID 119390296) has the molecular formula C19H30ClN3O3S and a molecular weight of 415.99 g/mol. Its IUPAC name is 1-ethylsulfonyl-4-phenyl-N-piperidin-4-ylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | 1-ethylsulfonyl-4-phenyl-N-piperidin-4-ylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119390296 |
| Molecular Formula | C19H30ClN3O3S |
| Molecular Weight | 415.99 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 1-ethylsulfonyl-4-phenyl-N-piperidin-4-ylpiperidine-4-carboxamide;hydrochloride |
| SMILES | CCS(=O)(=O)N1CCC(C(=O)NC2CCNCC2)(c2ccccc2)CC1.Cl |
| InChI | InChI=1S/C19H29N3O3S.ClH/c1-2-26(24,25)22-14-10-19(11-15-22,16-6-4-3-5-7-16)18(23)21-17-8-12-20-13-9-17;/h3-7,17,20H,2,8-15H2,1H3,(H,21,23);1H |
| InChIKey | DWMVDMPCQIHZTN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.99 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |