C20H32ClN3O3S — CID 119464480
1-ethylsulfonyl-4-phenyl-N-(piperidin-3-ylmethyl)piperidine-4-carboxamide;hydrochloride (PubChem CID 119464480) has the molecular formula C20H32ClN3O3S and a molecular weight of 430.01 g/mol. Its IUPAC name is 1-ethylsulfonyl-4-phenyl-N-(piperidin-3-ylmethyl)piperidine-4-carboxamide;hydrochloride.
| Compound Name | 1-ethylsulfonyl-4-phenyl-N-(piperidin-3-ylmethyl)piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119464480 |
| Molecular Formula | C20H32ClN3O3S |
| Molecular Weight | 430.01 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 1-ethylsulfonyl-4-phenyl-N-(piperidin-3-ylmethyl)piperidine-4-carboxamide;hydrochloride |
| SMILES | CCS(=O)(=O)N1CCC(C(=O)NCC2CCCNC2)(c2ccccc2)CC1.Cl |
| InChI | InChI=1S/C20H31N3O3S.ClH/c1-2-27(25,26)23-13-10-20(11-14-23,18-8-4-3-5-9-18)19(24)22-16-17-7-6-12-21-15-17;/h3-5,8-9,17,21H,2,6-7,10-16H2,1H3,(H,22,24);1H |
| InChIKey | AMGKATGFBQMKPN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.01 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |