C23H37N3O3S — CID 78837890
1-ethylsulfonyl-N-[3-(4-methylpiperidin-1-yl)propyl]-4-phenylpiperidine-4-carboxamide (PubChem CID 78837890) has the molecular formula C23H37N3O3S and a molecular weight of 435.63 g/mol. Its IUPAC name is 1-ethylsulfonyl-N-[3-(4-methylpiperidin-1-yl)propyl]-4-phenylpiperidine-4-carboxamide.
| Compound Name | 1-ethylsulfonyl-N-[3-(4-methylpiperidin-1-yl)propyl]-4-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 78837890 |
| Molecular Formula | C23H37N3O3S |
| Molecular Weight | 435.63 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 1-ethylsulfonyl-N-[3-(4-methylpiperidin-1-yl)propyl]-4-phenylpiperidine-4-carboxamide |
| SMILES | CCS(=O)(=O)N1CCC(C(=O)NCCCN2CCC(C)CC2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H37N3O3S/c1-3-30(28,29)26-18-12-23(13-19-26,21-8-5-4-6-9-21)22(27)24-14-7-15-25-16-10-20(2)11-17-25/h4-6,8-9,20H,3,7,10-19H2,1-2H3,(H,24,27) |
| InChIKey | BJILMZLMYGMZQF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.63 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|