C22H32N4O3S — CID 78816298
N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethylsulfonyl-4-phenylpiperidine-4-carboxamide (PubChem CID 78816298) has the molecular formula C22H32N4O3S and a molecular weight of 432.59 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethylsulfonyl-4-phenylpiperidine-4-carboxamide.
| Compound Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethylsulfonyl-4-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 78816298 |
| Molecular Formula | C22H32N4O3S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethylsulfonyl-4-phenylpiperidine-4-carboxamide |
| SMILES | CCS(=O)(=O)N1CCC(C(=O)NCCCn2nc(C)cc2C)(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H32N4O3S/c1-4-30(28,29)25-15-11-22(12-16-25,20-9-6-5-7-10-20)21(27)23-13-8-14-26-19(3)17-18(2)24-26/h5-7,9-10,17H,4,8,11-16H2,1-3H3,(H,23,27) |
| InChIKey | OFQHCEMRCSOMJC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|