C14H25ClN4O — CID 119266857
1-amino-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]cyclopentane-1-carboxamide;hydrochloride (PubChem CID 119266857) has the molecular formula C14H25ClN4O and a molecular weight of 300.83 g/mol. Its IUPAC name is 1-amino-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]cyclopentane-1-carboxamide;hydrochloride.
| Compound Name | 1-amino-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]cyclopentane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119266857 |
| Molecular Formula | C14H25ClN4O |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 1-amino-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]cyclopentane-1-carboxamide;hydrochloride |
| SMILES | Cc1cc(C)n(CCCNC(=O)C2(N)CCCC2)n1.Cl |
| InChI | InChI=1S/C14H24N4O.ClH/c1-11-10-12(2)18(17-11)9-5-8-16-13(19)14(15)6-3-4-7-14;/h10H,3-9,15H2,1-2H3,(H,16,19);1H |
| InChIKey | XJZYDCRTQJBJEX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|