C21H29N5O3S — CID 78902535
1-ethylsulfonyl-4-phenyl-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)piperidine-4-carboxamide (PubChem CID 78902535) has the molecular formula C21H29N5O3S and a molecular weight of 431.56 g/mol. Its IUPAC name is 1-ethylsulfonyl-4-phenyl-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)piperidine-4-carboxamide.
| Compound Name | 1-ethylsulfonyl-4-phenyl-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 78902535 |
| Molecular Formula | C21H29N5O3S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 1-ethylsulfonyl-4-phenyl-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)piperidine-4-carboxamide |
| SMILES | CCS(=O)(=O)N1CCC(C(=O)NCc2nnc3n2CCCC3)(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H29N5O3S/c1-2-30(28,29)25-14-11-21(12-15-25,17-8-4-3-5-9-17)20(27)22-16-19-24-23-18-10-6-7-13-26(18)19/h3-5,8-9H,2,6-7,10-16H2,1H3,(H,22,27) |
| InChIKey | YRPIPPQCJDPZSI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |