C23H30N2O4S — CID 78887706
N-[(3-ethoxyphenyl)methyl]-1-ethylsulfonyl-4-phenylpiperidine-4-carboxamide (PubChem CID 78887706) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is N-[(3-ethoxyphenyl)methyl]-1-ethylsulfonyl-4-phenylpiperidine-4-carboxamide.
| Compound Name | N-[(3-ethoxyphenyl)methyl]-1-ethylsulfonyl-4-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 78887706 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | N-[(3-ethoxyphenyl)methyl]-1-ethylsulfonyl-4-phenylpiperidine-4-carboxamide |
| SMILES | CCOc1cccc(CNC(=O)C2(c3ccccc3)CCN(S(=O)(=O)CC)CC2)c1 |
| InChI | InChI=1S/C23H30N2O4S/c1-3-29-21-12-8-9-19(17-21)18-24-22(26)23(20-10-6-5-7-11-20)13-15-25(16-14-23)30(27,28)4-2/h5-12,17H,3-4,13-16,18H2,1-2H3,(H,24,26) |
| InChIKey | UDGZWMJXDNYGLM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |