C21H31NO — CID 130268861
2-(3,7-dimethyl-1-phenyl-3-bicyclo[3.3.1]nonanyl)-N-ethylacetamide (PubChem CID 130268861) has the molecular formula C21H31NO and a molecular weight of 313.49 g/mol. Its IUPAC name is 2-(3,7-dimethyl-1-phenyl-3-bicyclo[3.3.1]nonanyl)-N-ethylacetamide.
| Compound Name | 2-(3,7-dimethyl-1-phenyl-3-bicyclo[3.3.1]nonanyl)-N-ethylacetamide |
|---|---|
| PubChem CID | 130268861 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | 2-(3,7-dimethyl-1-phenyl-3-bicyclo[3.3.1]nonanyl)-N-ethylacetamide |
| SMILES | CCNC(=O)CC1(C)CC2CC(C)CC(c3ccccc3)(C2)C1 |
| InChI | InChI=1S/C21H31NO/c1-4-22-19(23)14-20(3)12-17-10-16(2)11-21(13-17,15-20)18-8-6-5-7-9-18/h5-9,16-17H,4,10-15H2,1-3H3,(H,22,23) |
| InChIKey | YWICXEUSOOQCLQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |