C18H23NO2 — CID 137435973
3,7-dimethyl-N-oxo-1-phenylbicyclo[3.3.1]nonane-3-carboxamide (PubChem CID 137435973) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 3,7-dimethyl-N-oxo-1-phenylbicyclo[3.3.1]nonane-3-carboxamide.
| Compound Name | 3,7-dimethyl-N-oxo-1-phenylbicyclo[3.3.1]nonane-3-carboxamide |
|---|---|
| PubChem CID | 137435973 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 3,7-dimethyl-N-oxo-1-phenylbicyclo[3.3.1]nonane-3-carboxamide |
| SMILES | CC1CC2CC(C)(C(=O)N=O)CC(c3ccccc3)(C1)C2 |
| InChI | InChI=1S/C18H23NO2/c1-13-8-14-10-17(2,16(20)19-21)12-18(9-13,11-14)15-6-4-3-5-7-15/h3-7,13-14H,8-12H2,1-2H3 |
| InChIKey | RHPRJLNOSABFKX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |