C22H34ClNS — CID 162525948
6-(2-chloroethyl)-3,3,6,7-tetramethyl-1-phenylbicyclo[3.3.1]nonane;methanethioamide (PubChem CID 162525948) has the molecular formula C22H34ClNS and a molecular weight of 380.04 g/mol. Its IUPAC name is 6-(2-chloroethyl)-3,3,6,7-tetramethyl-1-phenylbicyclo[3.3.1]nonane;methanethioamide.
| Compound Name | 6-(2-chloroethyl)-3,3,6,7-tetramethyl-1-phenylbicyclo[3.3.1]nonane;methanethioamide |
|---|---|
| PubChem CID | 162525948 |
| Molecular Formula | C22H34ClNS |
| Molecular Weight | 380.04 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 6-(2-chloroethyl)-3,3,6,7-tetramethyl-1-phenylbicyclo[3.3.1]nonane;methanethioamide |
| SMILES | CC1CC2(c3ccccc3)CC(CC(C)(C)C2)C1(C)CCCl.NC=S |
| InChI | InChI=1S/C21H31Cl.CH3NS/c1-16-12-21(17-8-6-5-7-9-17)14-18(13-19(2,3)15-21)20(16,4)10-11-22;2-1-3/h5-9,16,18H,10-15H2,1-4H3;1H,(H2,2,3) |
| InChIKey | OWKCTKLCMUVGBI-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.04 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|