About (3,7-dimethyl-5-phenyl-2-bicyclo[3.3.1]nonanyl)methanol;uranium;hydrate
(3,7-dimethyl-5-phenyl-2-bicyclo[3.3.1]nonanyl)methanol;uranium;hydrate (PubChem CID 162754744) has the molecular formula C18H28O2U
and a molecular weight of 514.45 g/mol. Its IUPAC name is (3,7-dimethyl-5-phenyl-2-bicyclo[3.3.1]nonanyl)methanol;uranium;hydrate.
Molecular Properties
| Compound Name | (3,7-dimethyl-5-phenyl-2-bicyclo[3.3.1]nonanyl)methanol;uranium;hydrate |
| PubChem CID | 162754744 |
| Molecular Formula | C18H28O2U |
| Molecular Weight | 514.45 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | (3,7-dimethyl-5-phenyl-2-bicyclo[3.3.1]nonanyl)methanol;uranium;hydrate |
| SMILES | CC1CC2CC(c3ccccc3)(C1)CC(C)C2CO.O.[U] |
| InChI | InChI=1S/C18H26O.H2O.U/c1-13-8-15-11-18(9-13,10-14(2)17(15)12-19)16-6-4-3-5-7-16;;/h3-7,13-15,17,19H,8-12H2,1-2H3;1H2; |
| InChIKey | FTZFFTJJRKXWPY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 51.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 514.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3,7-dimethyl-5-phenyl-2-bicyclo[3.3.1]nonanyl)methanol;uranium;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,7-dimethyl-5-phenyl-2-bicyclo[3.3.1]nonanyl)methanol;uranium;hydrate?
The IUPAC name of (3,7-dimethyl-5-phenyl-2-bicyclo[3.3.1]nonanyl)methanol;uranium;hydrate (CID 162754744) is (3,7-dimethyl-5-phenyl-2-bicyclo[3.3.1]nonanyl)methanol;uranium;hydrate.
What is the SMILES notation for (3,7-dimethyl-5-phenyl-2-bicyclo[3.3.1]nonanyl)methanol;uranium;hydrate?
The canonical SMILES for (3,7-dimethyl-5-phenyl-2-bicyclo[3.3.1]nonanyl)methanol;uranium;hydrate is CC1CC2CC(c3ccccc3)(C1)CC(C)C2CO.O.[U].
What is the InChIKey of (3,7-dimethyl-5-phenyl-2-bicyclo[3.3.1]nonanyl)methanol;uranium;hydrate?
The InChIKey is FTZFFTJJRKXWPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O.H2O.U/c1-13-8-15-11-18(9-13,10-14(2)17(15)12-19)16-6-4-3-5-7-16;;/h3-7,13-15,17,19H,8-12H2,1-2H3;1H2;.
What are the key properties of (3,7-dimethyl-5-phenyl-2-bicyclo[3.3.1]nonanyl)methanol;uranium;hydrate?
(3,7-dimethyl-5-phenyl-2-bicyclo[3.3.1]nonanyl)methanol;uranium;hydrate has a molecular weight of 514.45 g/mol, XLogP of 3.18, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3,7-dimethyl-5-phenyl-2-bicyclo[3.3.1]nonanyl)methanol;uranium;hydrate is sourced from PubChem (CID 162754744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).