C19H23NO2 — CID 162525990
(6Z)-6-(2-methoxyethylidene)-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide (PubChem CID 162525990) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (6Z)-6-(2-methoxyethylidene)-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide.
| Compound Name | (6Z)-6-(2-methoxyethylidene)-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide |
|---|---|
| PubChem CID | 162525990 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (6Z)-6-(2-methoxyethylidene)-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxamide |
| SMILES | COC/C=C1/C2CC3(c4ccccc4)CC1C(C(N)=O)(C2)C3 |
| InChI | InChI=1S/C19H23NO2/c1-22-8-7-15-13-9-18(14-5-3-2-4-6-14)11-16(15)19(10-13,12-18)17(20)21/h2-7,13,16H,8-12H2,1H3,(H2,20,21)/b15-7- |
| InChIKey | NJWFHHNKXVDJNU-CHHVJCJISA-N |
| XLogP | 2.80 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|