C17H18O2 — CID 162525958
6-methylidene-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxylic acid (PubChem CID 162525958) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 6-methylidene-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxylic acid.
| Compound Name | 6-methylidene-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxylic acid |
|---|---|
| PubChem CID | 162525958 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 6-methylidene-1-phenyltricyclo[3.3.1.03,7]nonane-3-carboxylic acid |
| SMILES | C=C1C2CC3(c4ccccc4)CC1C(C(=O)O)(C2)C3 |
| InChI | InChI=1S/C17H18O2/c1-11-12-7-16(13-5-3-2-4-6-13)9-14(11)17(8-12,10-16)15(18)19/h2-6,12,14H,1,7-10H2,(H,18,19) |
| InChIKey | VBJFDBDVTIZMTJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|