C20H29ClO — CID 166985218
(6S)-6-(5-chloropentyl)-3-ethyl-3-phenylbicyclo[3.1.1]heptan-1-ol (PubChem CID 166985218) has the molecular formula C20H29ClO and a molecular weight of 320.90 g/mol. Its IUPAC name is (6S)-6-(5-chloropentyl)-3-ethyl-3-phenylbicyclo[3.1.1]heptan-1-ol.
| Compound Name | (6S)-6-(5-chloropentyl)-3-ethyl-3-phenylbicyclo[3.1.1]heptan-1-ol |
|---|---|
| PubChem CID | 166985218 |
| Molecular Formula | C20H29ClO |
| Molecular Weight | 320.90 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | (6S)-6-(5-chloropentyl)-3-ethyl-3-phenylbicyclo[3.1.1]heptan-1-ol |
| SMILES | CCC1(c2ccccc2)CC2CC(O)(C1)[C@H]2CCCCCCl |
| InChI | InChI=1S/C20H29ClO/c1-2-19(17-9-5-3-6-10-17)13-16-14-20(22,15-19)18(16)11-7-4-8-12-21/h3,5-6,9-10,16,18,22H,2,4,7-8,11-15H2,1H3/t16?,18-,19?,20?/m0/s1 |
| InChIKey | HKAZXAWREKZRCP-MHINKWEDSA-N |
| XLogP | 5.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.90 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|