C17H21ClO — CID 175917829
(1S,2R,3S,5S,7S)-2-benzyl-5-chloroadamantan-1-ol (PubChem CID 175917829) has the molecular formula C17H21ClO and a molecular weight of 276.81 g/mol. Its IUPAC name is (1S,2R,3S,5S,7S)-2-benzyl-5-chloroadamantan-1-ol.
| Compound Name | (1S,2R,3S,5S,7S)-2-benzyl-5-chloroadamantan-1-ol |
|---|---|
| PubChem CID | 175917829 |
| Molecular Formula | C17H21ClO |
| Molecular Weight | 276.81 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | (1S,2R,3S,5S,7S)-2-benzyl-5-chloroadamantan-1-ol |
| SMILES | O[C@@]12C[C@@H]3C[C@@H](C[C@@](Cl)(C3)C1)[C@H]2Cc1ccccc1 |
| InChI | InChI=1S/C17H21ClO/c18-16-8-13-6-14(10-16)15(17(19,9-13)11-16)7-12-4-2-1-3-5-12/h1-5,13-15,19H,6-11H2/t13-,14+,15-,16+,17+/m1/s1 |
| InChIKey | VBSSJTDRTURZQX-ALYAQQCSSA-N |
| XLogP | 3.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.81 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|