C21H28ClNO2 — CID 142524664
N-[(R)-[(1S,2R,3S,5S,7S)-5-chloro-1-hydroxy-2-adamantyl]-phenylmethyl]butanamide (PubChem CID 142524664) has the molecular formula C21H28ClNO2 and a molecular weight of 361.91 g/mol. Its IUPAC name is N-[(R)-[(1S,2R,3S,5S,7S)-5-chloro-1-hydroxy-2-adamantyl]-phenylmethyl]butanamide.
| Compound Name | N-[(R)-[(1S,2R,3S,5S,7S)-5-chloro-1-hydroxy-2-adamantyl]-phenylmethyl]butanamide |
|---|---|
| PubChem CID | 142524664 |
| Molecular Formula | C21H28ClNO2 |
| Molecular Weight | 361.91 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N-[(R)-[(1S,2R,3S,5S,7S)-5-chloro-1-hydroxy-2-adamantyl]-phenylmethyl]butanamide |
| SMILES | CCCC(=O)N[C@@H](c1ccccc1)[C@H]1[C@H]2C[C@@H]3C[C@](Cl)(C2)C[C@@]1(O)C3 |
| InChI | InChI=1S/C21H28ClNO2/c1-2-6-17(24)23-19(15-7-4-3-5-8-15)18-16-9-14-10-20(22,12-16)13-21(18,25)11-14/h3-5,7-8,14,16,18-19,25H,2,6,9-13H2,1H3,(H,23,24)/t14-,16+,18-,19+,20+,21+/m1/s1 |
| InChIKey | MXRRUBUSPHXMFJ-PEBWFPNZSA-N |
| XLogP | 4.19 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.91 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|