C17H20ClN3O — CID 135389616
(1R,2S,3R,5R,7R)-2-[azido(phenyl)methyl]-5-chloroadamantan-1-ol (PubChem CID 135389616) has the molecular formula C17H20ClN3O and a molecular weight of 317.82 g/mol. Its IUPAC name is (1R,2S,3R,5R,7R)-2-[azido(phenyl)methyl]-5-chloroadamantan-1-ol.
| Compound Name | (1R,2S,3R,5R,7R)-2-[azido(phenyl)methyl]-5-chloroadamantan-1-ol |
|---|---|
| PubChem CID | 135389616 |
| Molecular Formula | C17H20ClN3O |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | (1R,2S,3R,5R,7R)-2-[azido(phenyl)methyl]-5-chloroadamantan-1-ol |
| SMILES | [N-]=[N+]=NC(c1ccccc1)[C@@H]1[C@@H]2C[C@H]3C[C@@](Cl)(C2)C[C@]1(O)C3 |
| InChI | InChI=1S/C17H20ClN3O/c18-16-7-11-6-13(9-16)14(17(22,8-11)10-16)15(20-21-19)12-4-2-1-3-5-12/h1-5,11,13-15,22H,6-10H2/t11-,13+,14-,15?,16+,17+/m0/s1 |
| InChIKey | BJCQHIAFSIOTFU-OWODNVELSA-N |
| XLogP | 4.59 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|