C21H28ClNO2 — CID 154927292
N-[(R)-[(1S,2R,5S)-5-chloro-1-hydroxy-2-adamantyl]-phenylmethyl]-2-methylpropanamide (PubChem CID 154927292) has the molecular formula C21H28ClNO2 and a molecular weight of 361.91 g/mol. Its IUPAC name is N-[(R)-[(1S,2R,5S)-5-chloro-1-hydroxy-2-adamantyl]-phenylmethyl]-2-methylpropanamide.
| Compound Name | N-[(R)-[(1S,2R,5S)-5-chloro-1-hydroxy-2-adamantyl]-phenylmethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 154927292 |
| Molecular Formula | C21H28ClNO2 |
| Molecular Weight | 361.91 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N-[(R)-[(1S,2R,5S)-5-chloro-1-hydroxy-2-adamantyl]-phenylmethyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)N[C@@H](c1ccccc1)[C@H]1C2CC3C[C@](Cl)(C2)C[C@@]1(O)C3 |
| InChI | InChI=1S/C21H28ClNO2/c1-13(2)19(24)23-18(15-6-4-3-5-7-15)17-16-8-14-9-20(22,11-16)12-21(17,25)10-14/h3-7,13-14,16-18,25H,8-12H2,1-2H3,(H,23,24)/t14?,16?,17-,18+,20+,21+/m1/s1 |
| InChIKey | VXORCTVANIRKGT-ITATYWIUSA-N |
| XLogP | 4.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.91 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|