C15H24ClNO2 — CID 140965574
N-[(1S)-1-[(1R,2S,5R,7S)-5-chloro-1-hydroxy-2-adamantyl]propyl]acetamide (PubChem CID 140965574) has the molecular formula C15H24ClNO2 and a molecular weight of 285.81 g/mol. Its IUPAC name is N-[(1S)-1-[(1R,2S,5R,7S)-5-chloro-1-hydroxy-2-adamantyl]propyl]acetamide.
| Compound Name | N-[(1S)-1-[(1R,2S,5R,7S)-5-chloro-1-hydroxy-2-adamantyl]propyl]acetamide |
|---|---|
| PubChem CID | 140965574 |
| Molecular Formula | C15H24ClNO2 |
| Molecular Weight | 285.81 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N-[(1S)-1-[(1R,2S,5R,7S)-5-chloro-1-hydroxy-2-adamantyl]propyl]acetamide |
| SMILES | CC[C@H](NC(C)=O)[C@@H]1C2C[C@@H]3C[C@@](Cl)(C2)C[C@]1(O)C3 |
| InChI | InChI=1S/C15H24ClNO2/c1-3-12(17-9(2)18)13-11-4-10-5-14(16,7-11)8-15(13,19)6-10/h10-13,19H,3-8H2,1-2H3,(H,17,18)/t10-,11?,12+,13+,14-,15-/m1/s1 |
| InChIKey | RSXLHRWEMVISIY-BQZYLUNBSA-N |
| XLogP | 2.45 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.81 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|