C18H23ClO — CID 10017134
(1R,2R,3R,5R,7R)-5-chloro-2-(1-phenylethyl)adamantan-1-ol (PubChem CID 10017134) has the molecular formula C18H23ClO and a molecular weight of 290.83 g/mol. Its IUPAC name is (1R,2R,3R,5R,7R)-5-chloro-2-(1-phenylethyl)adamantan-1-ol.
| Compound Name | (1R,2R,3R,5R,7R)-5-chloro-2-(1-phenylethyl)adamantan-1-ol |
|---|---|
| PubChem CID | 10017134 |
| Molecular Formula | C18H23ClO |
| Molecular Weight | 290.83 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | (1R,2R,3R,5R,7R)-5-chloro-2-(1-phenylethyl)adamantan-1-ol |
| SMILES | CC(c1ccccc1)[C@H]1[C@@H]2C[C@H]3C[C@@](Cl)(C2)C[C@]1(O)C3 |
| InChI | InChI=1S/C18H23ClO/c1-12(14-5-3-2-4-6-14)16-15-7-13-8-17(19,10-15)11-18(16,20)9-13/h2-6,12-13,15-16,20H,7-11H2,1H3/t12?,13-,15+,16-,17+,18+/m0/s1 |
| InChIKey | UQLPQIVZWAWSPM-XVYVWSNDSA-N |
| XLogP | 4.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.83 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|