C22H25Cl2NO2 — CID 142441199
N-[(R)-[(1S,2R,3S,5S,7R)-1,5-dichloro-2-adamantyl]-phenylmethyl]-2-prop-2-ynoxyacetamide (PubChem CID 142441199) has the molecular formula C22H25Cl2NO2 and a molecular weight of 406.35 g/mol. Its IUPAC name is N-[(R)-[(1S,2R,3S,5S,7R)-1,5-dichloro-2-adamantyl]-phenylmethyl]-2-prop-2-ynoxyacetamide.
| Compound Name | N-[(R)-[(1S,2R,3S,5S,7R)-1,5-dichloro-2-adamantyl]-phenylmethyl]-2-prop-2-ynoxyacetamide |
|---|---|
| PubChem CID | 142441199 |
| Molecular Formula | C22H25Cl2NO2 |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N-[(R)-[(1S,2R,3S,5S,7R)-1,5-dichloro-2-adamantyl]-phenylmethyl]-2-prop-2-ynoxyacetamide |
| SMILES | C#CCOCC(=O)N[C@@H](c1ccccc1)[C@H]1[C@H]2C[C@@H]3C[C@](Cl)(C2)C[C@@]1(Cl)C3 |
| InChI | InChI=1S/C22H25Cl2NO2/c1-2-8-27-13-18(26)25-20(16-6-4-3-5-7-16)19-17-9-15-10-21(23,12-17)14-22(19,24)11-15/h1,3-7,15,17,19-20H,8-14H2,(H,25,26)/t15-,17+,19-,20+,21+,22+/m1/s1 |
| InChIKey | DQBFTLZVPMMFQW-LKTUSTNOSA-N |
| XLogP | 4.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|