C22H28ClNO3 — CID 9271041
[(2S)-1-[benzyl(methyl)amino]-1-oxopropan-2-yl] (5S,7R)-3-chloroadamantane-1-carboxylate (PubChem CID 9271041) has the molecular formula C22H28ClNO3 and a molecular weight of 389.92 g/mol. Its IUPAC name is [(2S)-1-[benzyl(methyl)amino]-1-oxopropan-2-yl] (5S,7R)-3-chloroadamantane-1-carboxylate.
| Compound Name | [(2S)-1-[benzyl(methyl)amino]-1-oxopropan-2-yl] (5S,7R)-3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 9271041 |
| Molecular Formula | C22H28ClNO3 |
| Molecular Weight | 389.92 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | [(2S)-1-[benzyl(methyl)amino]-1-oxopropan-2-yl] (5S,7R)-3-chloroadamantane-1-carboxylate |
| SMILES | C[C@H](OC(=O)C12C[C@@H]3C[C@@H](CC(Cl)(C3)C1)C2)C(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C22H28ClNO3/c1-15(19(25)24(2)13-16-6-4-3-5-7-16)27-20(26)21-9-17-8-18(10-21)12-22(23,11-17)14-21/h3-7,15,17-18H,8-14H2,1-2H3/t15-,17-,18+,21?,22?/m0/s1 |
| InChIKey | ICAWCPWTUUMHOK-KXYZOEOQSA-N |
| XLogP | 4.15 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.92 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|