C22H26ClNO3 — CID 42901597
[1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 3-chloroadamantane-1-carboxylate (PubChem CID 42901597) has the molecular formula C22H26ClNO3 and a molecular weight of 387.91 g/mol. Its IUPAC name is [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 3-chloroadamantane-1-carboxylate.
| Compound Name | [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 42901597 |
| Molecular Formula | C22H26ClNO3 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | [1-(2,3-dihydroindol-1-yl)-1-oxopropan-2-yl] 3-chloroadamantane-1-carboxylate |
| SMILES | CC(OC(=O)C12CC3CC(CC(Cl)(C3)C1)C2)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C22H26ClNO3/c1-14(19(25)24-7-6-17-4-2-3-5-18(17)24)27-20(26)21-9-15-8-16(10-21)12-22(23,11-15)13-21/h2-5,14-16H,6-13H2,1H3 |
| InChIKey | VZKWFPCDXCQDFS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|