C21H24BrNO3 — CID 2371875
[2-(2,3-dihydroindol-1-yl)-2-oxoethyl] (5S,7R)-3-bromoadamantane-1-carboxylate (PubChem CID 2371875) has the molecular formula C21H24BrNO3 and a molecular weight of 418.33 g/mol. Its IUPAC name is [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] (5S,7R)-3-bromoadamantane-1-carboxylate.
| Compound Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] (5S,7R)-3-bromoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 2371875 |
| Molecular Formula | C21H24BrNO3 |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] (5S,7R)-3-bromoadamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12C[C@@H]3C[C@@H](CC(Br)(C3)C1)C2)N1CCc2ccccc21 |
| InChI | InChI=1S/C21H24BrNO3/c22-21-10-14-7-15(11-21)9-20(8-14,13-21)19(25)26-12-18(24)23-6-5-16-3-1-2-4-17(16)23/h1-4,14-15H,5-13H2/t14-,15+,20?,21? |
| InChIKey | VTCBLRKBMUZNJM-XFKLWTPLSA-N |
| XLogP | 3.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|