C17H15BrN2O2 — CID 7670644
2-[(Z)-(2-bromophenyl)methylideneamino]oxy-1-(2,3-dihydroindol-1-yl)ethanone (PubChem CID 7670644) has the molecular formula C17H15BrN2O2 and a molecular weight of 359.22 g/mol. Its IUPAC name is 2-[(Z)-(2-bromophenyl)methylideneamino]oxy-1-(2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 2-[(Z)-(2-bromophenyl)methylideneamino]oxy-1-(2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 7670644 |
| Molecular Formula | C17H15BrN2O2 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 2-[(Z)-(2-bromophenyl)methylideneamino]oxy-1-(2,3-dihydroindol-1-yl)ethanone |
| SMILES | O=C(CO/N=C\c1ccccc1Br)N1CCc2ccccc21 |
| InChI | InChI=1S/C17H15BrN2O2/c18-15-7-3-1-6-14(15)11-19-22-12-17(21)20-10-9-13-5-2-4-8-16(13)20/h1-8,11H,9-10,12H2/b19-11- |
| InChIKey | WDOAKBNOVZJDGI-ODLFYWEKSA-N |
| XLogP | 3.39 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|