C15H15N3O2S — CID 51228665
N'-[2-(2,3-dihydroindol-1-yl)-2-oxoethoxy]thiophene-3-carboximidamide (PubChem CID 51228665) has the molecular formula C15H15N3O2S and a molecular weight of 301.37 g/mol. Its IUPAC name is N'-[2-(2,3-dihydroindol-1-yl)-2-oxoethoxy]thiophene-3-carboximidamide.
| Compound Name | N'-[2-(2,3-dihydroindol-1-yl)-2-oxoethoxy]thiophene-3-carboximidamide |
|---|---|
| PubChem CID | 51228665 |
| Molecular Formula | C15H15N3O2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | N'-[2-(2,3-dihydroindol-1-yl)-2-oxoethoxy]thiophene-3-carboximidamide |
| SMILES | N/C(=N/OCC(=O)N1CCc2ccccc21)c1ccsc1 |
| InChI | InChI=1S/C15H15N3O2S/c16-15(12-6-8-21-10-12)17-20-9-14(19)18-7-5-11-3-1-2-4-13(11)18/h1-4,6,8,10H,5,7,9H2,(H2,16,17) |
| InChIKey | OYXIFLFDJDJYDR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|