C21H22N4O4S2 — CID 55411888
N'-[2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-2-oxoethoxy]thiophene-3-carboximidamide (PubChem CID 55411888) has the molecular formula C21H22N4O4S2 and a molecular weight of 458.57 g/mol. Its IUPAC name is N'-[2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-2-oxoethoxy]thiophene-3-carboximidamide.
| Compound Name | N'-[2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-2-oxoethoxy]thiophene-3-carboximidamide |
|---|---|
| PubChem CID | 55411888 |
| Molecular Formula | C21H22N4O4S2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | N'-[2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-2-oxoethoxy]thiophene-3-carboximidamide |
| SMILES | N/C(=N/OCC(=O)N1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1)c1ccsc1 |
| InChI | InChI=1S/C21H22N4O4S2/c22-21(18-7-12-30-15-18)23-29-14-20(26)24-8-10-25(11-9-24)31(27,28)19-6-5-16-3-1-2-4-17(16)13-19/h1-7,12-13,15H,8-11,14H2,(H2,22,23) |
| InChIKey | MLUWGEBJBOJJNI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|